Structure of PDB 6lzl Chain A Binding Site BS02 |
|
|
Ligand ID | AYR |
InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ |
InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(/C=C/C=C/c1ccc2OCOc2c1)N3CCCCC3 | OpenEye OEToolkits 2.0.6 | c1cc2c(cc1/C=C/C=C/C(=O)N3CCCCC3)OCO2 | CACTVS 3.385 | O=C(C=CC=Cc1ccc2OCOc2c1)N3CCCCC3 | ACDLabs 12.01 | C(c2ccc1OCOc1c2)=[C@H]C=[C@H]C(N3CCCCC3)=O | OpenEye OEToolkits 2.0.6 | c1cc2c(cc1C=CC=CC(=O)N3CCCCC3)OCO2 |
|
Formula | C17 H19 N O3 |
Name | (2E,4E)-5-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one |
ChEMBL | CHEMBL43185 |
DrugBank | DB12582 |
ZINC | ZINC000001529772
|
PDB chain | 6lzl Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|