Structure of PDB 6l6w Chain A Binding Site BS02 |
|
|
Ligand ID | E79 |
InChI | InChI=1S/C6H11NO5/c1-3(2-4(8)9)7-5(10)6(11)12/h3,5,7,10H,2H2,1H3,(H,8,9)(H,11,12)/t3-,5-/m1/s1 |
InChIKey | JHNXGAXXJGEJGB-NQXXGFSBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](CC(O)=O)N[CH](O)C(O)=O | OpenEye OEToolkits 2.0.7 | C[C@H](CC(=O)O)N[C@@H](C(=O)O)O | OpenEye OEToolkits 2.0.7 | CC(CC(=O)O)NC(C(=O)O)O | CACTVS 3.385 | C[C@H](CC(O)=O)N[C@H](O)C(O)=O |
|
Formula | C6 H11 N O5 |
Name | (3R)-3-[[(1R)-1,2-bis(oxidanyl)-2-oxidanylidene-ethyl]amino]butanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6l6w Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|