Structure of PDB 6j3b Chain A Binding Site BS02 |
|
|
Ligand ID | B5O |
InChI | InChI=1S/C22H20F3N3O2/c1-11(2)13-6-19-22(20(30)7-13)26-27-28(19)14-8-17(24)21(18(25)9-14)15-5-12(10-29)3-4-16(15)23/h3-5,8-9,11,13,29H,6-7,10H2,1-2H3/t13-/m1/s1 |
InChIKey | PDEIRWICIYOXPB-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[CH]1CC(=O)c2nnn(c3cc(F)c(c(F)c3)c4cc(CO)ccc4F)c2C1 | OpenEye OEToolkits 2.0.6 | CC(C)[C@@H]1Cc2c(nnn2c3cc(c(c(c3)F)c4cc(ccc4F)CO)F)C(=O)C1 | CACTVS 3.385 | CC(C)[C@H]1CC(=O)c2nnn(c3cc(F)c(c(F)c3)c4cc(CO)ccc4F)c2C1 | OpenEye OEToolkits 2.0.6 | CC(C)C1Cc2c(nnn2c3cc(c(c(c3)F)c4cc(ccc4F)CO)F)C(=O)C1 |
|
Formula | C22 H20 F3 N3 O2 |
Name | (6R)-1-[3,5-bis(fluoranyl)-4-[2-fluoranyl-5-(hydroxymethyl)phenyl]phenyl]-6-propan-2-yl-6,7-dihydro-5H-benzotriazol-4-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6j3b Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|