Structure of PDB 6ihh Chain A Binding Site BS02 |
|
|
Ligand ID | A6O |
InChI | InChI=1S/C20H26O3/c1-3-20(18(21)9-10-19(20)22)12-11-14-5-4-6-15-13-16(23-2)7-8-17(14)15/h7-8,11,13,18,21H,3-6,9-10,12H2,1-2H3/b14-11+/t18-,20+/m0/s1 |
InChIKey | ZXYHLOFRRMDJAQ-OUBQQWGRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[C@@]1(C/C=C/2CCCc3cc(OC)ccc/23)[C@@H](O)CCC1=O | OpenEye OEToolkits 2.0.6 | CC[C@]1([C@H](CCC1=O)O)C/C=C/2\CCCc3c2ccc(c3)OC | CACTVS 3.385 | CC[C]1(CC=C2CCCc3cc(OC)ccc23)[CH](O)CCC1=O | OpenEye OEToolkits 2.0.6 | CCC1(C(CCC1=O)O)CC=C2CCCc3c2ccc(c3)OC |
|
Formula | C20 H26 O3 |
Name | (2R,3S)-2-ethyl-2-[(2E)-2-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)ethyl]-3-oxidanyl-cyclopentan-1-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ihh Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|