Structure of PDB 6hgx Chain A Binding Site BS02 |
|
|
Ligand ID | G3T |
InChI | InChI=1S/C22H35N3O3/c1-22(2,3)25-13-14-27-20(15-25)16-28-19-11-9-18(10-12-19)24-21(26)23-17-7-5-4-6-8-17/h9-12,17,20H,4-8,13-16H2,1-3H3,(H2,23,24,26)/t20-/m0/s1 |
InChIKey | PSVUAGRHPQWOOO-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)(C)N1CCO[C@@H](C1)COc2ccc(cc2)NC(=O)NC3CCCCC3 | CACTVS 3.385 | CC(C)(C)N1CCO[CH](COc2ccc(NC(=O)NC3CCCCC3)cc2)C1 | CACTVS 3.385 | CC(C)(C)N1CCO[C@H](COc2ccc(NC(=O)NC3CCCCC3)cc2)C1 | OpenEye OEToolkits 2.0.6 | CC(C)(C)N1CCOC(C1)COc2ccc(cc2)NC(=O)NC3CCCCC3 |
|
Formula | C22 H35 N3 O3 |
Name | 1-[4-[[(2~{S})-4-~{tert}-butylmorpholin-2-yl]methoxy]phenyl]-3-cyclohexyl-urea |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6hgx Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|