Structure of PDB 6gg8 Chain A Binding Site BS02 |
|
|
Ligand ID | EY8 |
InChI | InChI=1S/C18H16FN3O6S/c19-11-2-3-14-16(6-11)27-7-12(9-29(20,25)26)22(14)18(24)10-1-4-15-13(5-10)21-17(23)8-28-15/h1-6,12H,7-9H2,(H,21,23)(H2,20,25,26)/t12-/m1/s1 |
InChIKey | FDWPXNLUFQNWMH-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc2c(cc1C(=O)N3c4ccc(cc4OCC3CS(=O)(=O)N)F)NC(=O)CO2 | CACTVS 3.385 | N[S](=O)(=O)C[CH]1COc2cc(F)ccc2N1C(=O)c3ccc4OCC(=O)Nc4c3 | CACTVS 3.385 | N[S](=O)(=O)C[C@H]1COc2cc(F)ccc2N1C(=O)c3ccc4OCC(=O)Nc4c3 | OpenEye OEToolkits 2.0.6 | c1cc2c(cc1C(=O)N3c4ccc(cc4OC[C@@H]3CS(=O)(=O)N)F)NC(=O)CO2 |
|
Formula | C18 H16 F N3 O6 S |
Name | [(3~{R})-7-fluoranyl-4-[(3-oxidanylidene-4~{H}-1,4-benzoxazin-6-yl)carbonyl]-2,3-dihydro-1,4-benzoxazin-3-yl]methanesulfonamide |
ChEMBL | CHEMBL4532472 |
DrugBank | |
ZINC |
|
PDB chain | 6gg8 Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|