Structure of PDB 6gev Chain A Binding Site BS02 |
|
|
Ligand ID | EWN |
InChI | InChI=1S/C21H21FN2O4/c1-12(2)7-15-10-27-19-9-14(22)4-5-17(19)24(15)21(26)13-3-6-18-16(8-13)23-20(25)11-28-18/h3-6,8-9,12,15H,7,10-11H2,1-2H3,(H,23,25)/t15-/m0/s1 |
InChIKey | CERMKIOTMWNAGM-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[CH]1COc2cc(F)ccc2N1C(=O)c3ccc4OCC(=O)Nc4c3 | CACTVS 3.385 | CC(C)C[C@H]1COc2cc(F)ccc2N1C(=O)c3ccc4OCC(=O)Nc4c3 | OpenEye OEToolkits 2.0.6 | CC(C)CC1COc2cc(ccc2N1C(=O)c3ccc4c(c3)NC(=O)CO4)F | OpenEye OEToolkits 2.0.6 | CC(C)C[C@H]1COc2cc(ccc2N1C(=O)c3ccc4c(c3)NC(=O)CO4)F |
|
Formula | C21 H21 F N2 O4 |
Name | 6-[[(3~{S})-7-fluoranyl-3-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-4-yl]carbonyl]-4~{H}-1,4-benzoxazin-3-one |
ChEMBL | CHEMBL4468672 |
DrugBank | |
ZINC |
|
PDB chain | 6gev Chain A Residue 1104
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|