Structure of PDB 6dz0 Chain A Binding Site BS02 |
|
|
Ligand ID | OS3 |
InChI | InChI=1S/C17H23N5OS/c1-2-3-4-5-24-10-13-8-22(9-14(13)23)7-12-6-19-16-15(12)20-11-21-17(16)18/h1,6,11,13-14,19,23H,3-5,7-10H2,(H2,18,20,21)/t13-,14+/m1/s1 |
InChIKey | QRFSYYUFBJRRLL-KGLIPLIRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncnc2c(CN3C[CH](O)[CH](CSCCCC#C)C3)c[nH]c12 | CACTVS 3.385 | Nc1ncnc2c(CN3C[C@H](O)[C@@H](CSCCCC#C)C3)c[nH]c12 | ACDLabs 12.01 | Nc1c2ncc(c2ncn1)CN3CC(O)C(C3)CSCCCC#C | OpenEye OEToolkits 2.0.6 | C#CCCCSCC1CN(CC1O)Cc2c[nH]c3c2ncnc3N | OpenEye OEToolkits 2.0.6 | C#CCCCSC[C@H]1CN(C[C@@H]1O)Cc2c[nH]c3c2ncnc3N |
|
Formula | C17 H23 N5 O S |
Name | (3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-{[(pent-4-yn-1-yl)sulfanyl]methyl}pyrrolidin-3-ol |
ChEMBL | CHEMBL4465346 |
DrugBank | |
ZINC |
|
PDB chain | 6dz0 Chain A Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|