Structure of PDB 6dq8 Chain A Binding Site BS02 |
|
|
Ligand ID | H6T |
InChI | InChI=1S/C22H23ClN2O3S/c1-25-11-4-5-14(25)9-12-28-20(15-6-2-3-7-17(15)23)19-13-18-21(29-19)16(22(26)27)8-10-24-18/h2-3,6-8,10,13-14,20H,4-5,9,11-12H2,1H3,(H,26,27)/t14-,20-/m0/s1 |
InChIKey | CKHGFLIUOABPPV-XOBRGWDASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCC[CH]1CCO[CH](c2sc3c(c2)nccc3C(O)=O)c4ccccc4Cl | OpenEye OEToolkits 2.0.6 | CN1CCC[C@H]1CCO[C@@H](c2ccccc2Cl)c3cc4c(s3)c(ccn4)C(=O)O | CACTVS 3.385 | CN1CCC[C@H]1CCO[C@H](c2sc3c(c2)nccc3C(O)=O)c4ccccc4Cl | ACDLabs 12.01 | c1(c(cccc1)C(c2sc3c(c2)nccc3C(=O)O)OCCC4CCCN4C)Cl | OpenEye OEToolkits 2.0.6 | CN1CCCC1CCOC(c2ccccc2Cl)c3cc4c(s3)c(ccn4)C(=O)O |
|
Formula | C22 H23 Cl N2 O3 S |
Name | 2-[(S)-(2-chlorophenyl){2-[(2S)-1-methylpyrrolidin-2-yl]ethoxy}methyl]thieno[3,2-b]pyridine-7-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6dq8 Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|