Structure of PDB 6czn Chain A Binding Site BS02 |
|
|
Ligand ID | FNJ |
InChI | InChI=1S/C22H22O2/c1-2-21(16-8-12-19(23)13-9-16)22(17-6-4-3-5-7-17)18-10-14-20(24)15-11-18/h3-15,21-24H,2H2,1H3/t21-,22+/m0/s1 |
InChIKey | KTDYSTOLKGILFR-FCHUYYIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCC(c1ccc(cc1)O)C(c2ccccc2)c3ccc(cc3)O | OpenEye OEToolkits 2.0.6 | CC[C@@H](c1ccc(cc1)O)[C@H](c2ccccc2)c3ccc(cc3)O | CACTVS 3.385 | CC[C@H]([C@H](c1ccccc1)c2ccc(O)cc2)c3ccc(O)cc3 | CACTVS 3.385 | CC[CH]([CH](c1ccccc1)c2ccc(O)cc2)c3ccc(O)cc3 | ACDLabs 12.01 | c1c(ccc(c1)O)C(CC)C(c2ccc(O)cc2)c3ccccc3 |
|
Formula | C22 H22 O2 |
Name | 4,4'-[(1R,2R)-1-phenylbutane-1,2-diyl]diphenol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6czn Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|