Structure of PDB 6ck6 Chain A Binding Site BS02 |
|
|
Ligand ID | N45 |
InChI | InChI=1S/C17H20N6O2/c1-10-7-11(21-13-8-12(18)19-9-20-13)16(25)23-14(10)15(24)22-17(23)5-3-2-4-6-17/h7-9H,2-6H2,1H3,(H,22,24)(H3,18,19,20,21) |
InChIKey | HKTBYUWLRDZAJK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C3C1=C(C)C=C(C(N1C2(CCCCC2)N3)=O)Nc4ncnc(c4)N | CACTVS 3.385 | CC1=C2N(C(=O)C(=C1)Nc3cc(N)ncn3)C4(CCCCC4)NC2=O | OpenEye OEToolkits 2.0.6 | CC1=C2C(=O)NC3(N2C(=O)C(=C1)Nc4cc(ncn4)N)CCCCC3 |
|
Formula | C17 H20 N6 O2 |
Name | 6'-[(6-aminopyrimidin-4-yl)amino]-8'-methyl-2'H-spiro[cyclohexane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione |
ChEMBL | CHEMBL4073443 |
DrugBank | DB15219 |
ZINC | ZINC000575623807
|
PDB chain | 6ck6 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|