Structure of PDB 6bdp Chain A Binding Site BS02 |
|
|
Ligand ID | DE4 |
InChI | InChI=1S/C18H21N3O3/c22-13-15-6-7-16(10-18(15)21(23)24)19-17-8-9-20(12-17)11-14-4-2-1-3-5-14/h1-7,10,17,19,22H,8-9,11-13H2/t17-/m1/s1 |
InChIKey | BWQQLSMUSJPPCM-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CN2CC[C@H](C2)Nc3ccc(c(c3)[N+](=O)[O-])CO | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CN2CCC(C2)Nc3ccc(c(c3)[N+](=O)[O-])CO | CACTVS 3.385 | OCc1ccc(N[C@@H]2CCN(C2)Cc3ccccc3)cc1[N+]([O-])=O | CACTVS 3.385 | OCc1ccc(N[CH]2CCN(C2)Cc3ccccc3)cc1[N+]([O-])=O | ACDLabs 12.01 | [O-][N+](=O)c1cc(ccc1CO)NC1CCN(Cc2ccccc2)C1 |
|
Formula | C18 H21 N3 O3 |
Name | (4-{[(3R)-1-benzylpyrrolidin-3-yl]amino}-2-nitrophenyl)methanol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6bdp Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|