Structure of PDB 6b50 Chain A Binding Site BS02 |
|
|
Ligand ID | OAQ |
InChI | InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3/t12-/m0/s1 |
InChIKey | XCGYUJZMCCFSRP-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)NC[C@@H]1CCc2cc(c(cc2N1)[N+](=O)[O-])CO | ACDLabs 12.01 | [O-][N+](=O)c1c(cc2c(c1)NC(CC2)CNC(C)C)CO | OpenEye OEToolkits 1.7.6 | CC(C)NCC1CCc2cc(c(cc2N1)[N+](=O)[O-])CO | CACTVS 3.385 | CC(C)NC[CH]1CCc2cc(CO)c(cc2N1)[N+]([O-])=O | CACTVS 3.385 | CC(C)NC[C@@H]1CCc2cc(CO)c(cc2N1)[N+]([O-])=O |
|
Formula | C14 H21 N3 O3 |
Name | {(2S)-7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl}methanol; Oxamniquine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000896836
|
PDB chain | 6b50 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|