Structure of PDB 6arv Chain A Binding Site BS02 |
|
|
Ligand ID | BW7 |
InChI | InChI=1S/C22H29N5O3/c1-15(2)27-22-19(13-24-27)21(26-6-8-29-9-7-26)11-20(25-22)16-4-3-5-18(10-16)30-14-17(28)12-23/h3-5,10-11,13,15,17,28H,6-9,12,14,23H2,1-2H3/t17-/m1/s1 |
InChIKey | CPPUUUMUDLYZRX-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)n1ncc2c(cc(nc12)c3cccc(OC[CH](O)CN)c3)N4CCOCC4 | CACTVS 3.385 | CC(C)n1ncc2c(cc(nc12)c3cccc(OC[C@H](O)CN)c3)N4CCOCC4 | OpenEye OEToolkits 2.0.6 | CC(C)n1c2c(cn1)c(cc(n2)c3cccc(c3)OCC(CN)O)N4CCOCC4 | OpenEye OEToolkits 2.0.6 | CC(C)n1c2c(cn1)c(cc(n2)c3cccc(c3)OC[C@@H](CN)O)N4CCOCC4 | ACDLabs 12.01 | C1COCCN1c2cc(nc3c2cnn3C(C)C)c4cccc(c4)OCC(O)CN |
|
Formula | C22 H29 N5 O3 |
Name | (2R)-1-amino-3-{3-[4-(morpholin-4-yl)-1-(propan-2-yl)-1H-pyrazolo[3,4-b]pyridin-6-yl]phenoxy}propan-2-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6arv Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|