Structure of PDB 5zf8 Chain A Binding Site BS02 |
|
|
Ligand ID | 9BO |
InChI | InChI=1S/C21H27ClO5/c1-12(7-6-8-13(2)15(4)27-16(5)24)9-10-17-20(25)18(11-23)14(3)19(22)21(17)26/h8-9,11,15,25-26H,6-7,10H2,1-5H3/b12-9+,13-8+/t15-/m0/s1 |
InChIKey | YBGJUDVVSGWLOR-KYXQLXBKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](OC(C)=O)C(C)=CCCC(C)=CCc1c(O)c(Cl)c(C)c(C=O)c1O | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(c(c1Cl)O)C/C=C(\C)/CC/C=C(\C)/[C@H](C)OC(=O)C)O)C=O | CACTVS 3.385 | C[C@H](OC(C)=O)/C(C)=C/CC\C(C)=C\Cc1c(O)c(Cl)c(C)c(C=O)c1O | ACDLabs 12.01 | CC(=O)OC(C)C(C)=[C@H]CCC(=[C@H]Cc1c(c(C=O)c(C)c(Cl)c1O)O)C | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(c(c1Cl)O)CC=C(C)CCC=C(C)C(C)OC(=O)C)O)C=O |
|
Formula | C21 H27 Cl O5 |
Name | (2S,3E,7E)-9-(3-chloro-5-formyl-2,6-dihydroxy-4-methylphenyl)-3,7-dimethylnona-3,7-dien-2-yl acetate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5zf8 Chain A Residue 410
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|