Structure of PDB 5zc6 Chain A Binding Site BS02 |
|
|
Ligand ID | KBF |
InChI | InChI=1S/C16H17NO3/c18-15-9-12-5-2-1-4-11(12)8-14(15)16(19)17-10-13-6-3-7-20-13/h1-2,4-5,8-9,13,18H,3,6-7,10H2,(H,17,19)/t13-/m1/s1 |
InChIKey | DBYOJRHWEJEBCL-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc2cc(c(cc2c1)C(=O)NC[C@H]3CCCO3)O | OpenEye OEToolkits 2.0.6 | c1ccc2cc(c(cc2c1)C(=O)NCC3CCCO3)O | CACTVS 3.385 | Oc1cc2ccccc2cc1C(=O)NC[CH]3CCCO3 | CACTVS 3.385 | Oc1cc2ccccc2cc1C(=O)NC[C@H]3CCCO3 |
|
Formula | C16 H17 N O3 |
Name | 3-oxidanyl-~{N}-[[(2~{R})-oxolan-2-yl]methyl]naphthalene-2-carboxamide; 3-hydroxy-N-(tetrahydrofuran-2-ylmethyl)naphthalene-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013007213
|
PDB chain | 5zc6 Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.5.2: small monomeric GTPase. |
|
|
|