Structure of PDB 5z12 Chain A Binding Site BS02 |
|
|
Ligand ID | 33Y |
InChI | InChI=1S/C25H24F2N2O3/c1-14(2)32-24(31)17-12-29(23(30)15-9-10-18(26)19(27)11-15)13-25(3,4)21-16-7-5-6-8-20(16)28-22(17)21/h5-12,14,28H,13H2,1-4H3 |
InChIKey | INASOKQDNHHMRE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)OC(=O)C1=CN(CC(C)(C)c2c1[nH]c3ccccc23)C(=O)c4ccc(F)c(F)c4 | OpenEye OEToolkits 1.5.0 | CC(C)OC(=O)C1=CN(CC(c2c1[nH]c3c2cccc3)(C)C)C(=O)c4ccc(c(c4)F)F | ACDLabs 10.04 | Fc1ccc(cc1F)C(=O)N4C=C(c3c(c2ccccc2n3)C(C4)(C)C)C(=O)OC(C)C |
|
Formula | C25 H24 F2 N2 O3 |
Name | 1-methylethyl 3-[(3,4-difluorophenyl)carbonyl]-1,1-dimethyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |
ChEMBL | CHEMBL454138 |
DrugBank | DB12719 |
ZINC | ZINC000040848320
|
PDB chain | 5z12 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|