Structure of PDB 5yxl Chain A Binding Site BS02 |
|
|
Ligand ID | NIW |
InChI | InChI=1S/C21H24N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12H,9-10H2,1-5H3 |
InChIKey | SJJUCKCPGPCJQM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COCCOC(=O)c1c(C)nc(C)c(C(=O)OC(C)C)c1c2cccc(c2)[N+]([O-])=O | ACDLabs 12.01 | O=C(c1c(c(c(nc1C)C)C(OC(C)C)=O)c2cc([N+]([O-])=O)ccc2)OCCOC | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(c(n1)C)C(=O)OC(C)C)c2cccc(c2)[N+](=O)[O-])C(=O)OCCOC |
|
Formula | C21 H24 N2 O7 |
Name | 2-methoxyethyl propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate; Nimodipine M (dehydro) |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5yxl Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|