Structure of PDB 5yf1 Chain A Binding Site BS02 |
|
|
Ligand ID | 8V0 |
InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1c(nc[nH]1)C[C@@H](C(=O)O)NC(=O)CCN | CACTVS 3.385 | NCCC(=O)N[CH](Cc1c[nH]cn1)C(O)=O | CACTVS 3.385 | NCCC(=O)N[C@@H](Cc1c[nH]cn1)C(O)=O | OpenEye OEToolkits 2.0.6 | c1c(nc[nH]1)CC(C(=O)O)NC(=O)CCN |
|
Formula | C9 H14 N4 O3 |
Name | (2~{S})-2-(3-azanylpropanoylamino)-3-(1~{H}-imidazol-4-yl)propanoic acid |
ChEMBL | CHEMBL242948 |
DrugBank | DB11695 |
ZINC | ZINC000002040854
|
PDB chain | 5yf1 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.22: carnosine N-methyltransferase. |
|
|
|