Structure of PDB 5y1j Chain A Binding Site BS02 |
|
|
Ligand ID | D5H |
InChI | InChI=1S/C20H18FNO4/c1-26-14-5-2-4-12(10-14)13-8-9-18(17(21)11-13)22-19(23)15-6-3-7-16(15)20(24)25/h2,4-5,8-11H,3,6-7H2,1H3,(H,22,23)(H,24,25) |
InChIKey | XPRDUGXOWVXZLL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1cccc(c1)c2ccc(c(c2)F)NC(=O)C3=C(CCC3)C(=O)O | CACTVS 3.385 | COc1cccc(c1)c2ccc(NC(=O)C3=C(CCC3)C(O)=O)c(F)c2 |
|
Formula | C20 H18 F N O4 |
Name | 2-[[2-fluoranyl-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid; Vidofludimus, 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
ChEMBL | CHEMBL197194 |
DrugBank | DB15446 |
ZINC | ZINC000014960644
|
PDB chain | 5y1j Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|