Structure of PDB 5w49 Chain A Binding Site BS02 |
|
|
Ligand ID | 9W1 |
InChI | InChI=1S/C20H22N6O3/c1-12-8-15(23-14-4-3-5-16(9-14)28-2)10-17(22-12)13-6-7-26(11-13)20(27)18-19(21)25-29-24-18/h3-5,8-10,13H,6-7,11H2,1-2H3,(H2,21,25)(H,22,23)/t13-/m1/s1 |
InChIKey | BJUGLSYIEXNITK-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cccc(Nc2cc(C)nc(c2)[C@@H]3CCN(C3)C(=O)c4nonc4N)c1 | ACDLabs 12.01 | n1onc(c1C(N2CC(CC2)c3cc(cc(n3)C)Nc4cc(ccc4)OC)=O)N | OpenEye OEToolkits 2.0.6 | Cc1cc(cc(n1)[C@@H]2CCN(C2)C(=O)c3c(non3)N)Nc4cccc(c4)OC | OpenEye OEToolkits 2.0.6 | Cc1cc(cc(n1)C2CCN(C2)C(=O)c3c(non3)N)Nc4cccc(c4)OC | CACTVS 3.385 | COc1cccc(Nc2cc(C)nc(c2)[CH]3CCN(C3)C(=O)c4nonc4N)c1 |
|
Formula | C20 H22 N6 O3 |
Name | (4-amino-1,2,5-oxadiazol-3-yl)[(3R)-3-{4-[(3-methoxyphenyl)amino]-6-methylpyridin-2-yl}pyrrolidin-1-yl]methanone |
ChEMBL | |
DrugBank | |
ZINC | ZINC000257207887
|
PDB chain | 5w49 Chain A Residue 508
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|