Structure of PDB 5vp0 Chain A Binding Site BS02 |
|
|
Ligand ID | 9GJ |
InChI | InChI=1S/C19H18F4N4O5/c1-30-9-14(10-3-4-15(12(20)5-10)32-19(21,22)23)26-18(29)27-8-16(28)25-13-6-11(31-2)7-24-17(13)27/h3-7,14H,8-9H2,1-2H3,(H,25,28)(H,26,29)/t14-/m1/s1 |
InChIKey | AWJSRXUQLSPAOI-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COC[C@H](c1ccc(c(c1)F)OC(F)(F)F)NC(=O)N2CC(=O)Nc3c2ncc(c3)OC | OpenEye OEToolkits 2.0.6 | COCC(c1ccc(c(c1)F)OC(F)(F)F)NC(=O)N2CC(=O)Nc3c2ncc(c3)OC | CACTVS 3.385 | COC[C@@H](NC(=O)N1CC(=O)Nc2cc(OC)cnc12)c3ccc(OC(F)(F)F)c(F)c3 | ACDLabs 12.01 | n1cc(cc2NC(=O)CN(c12)C(NC(c3cc(c(cc3)OC(F)(F)F)F)COC)=O)OC | CACTVS 3.385 | COC[CH](NC(=O)N1CC(=O)Nc2cc(OC)cnc12)c3ccc(OC(F)(F)F)c(F)c3 |
|
Formula | C19 H18 F4 N4 O5 |
Name | N-{(1S)-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-methoxyethyl}-7-methoxy-2-oxo-2,3-dihydropyrido[2,3-b]pyrazine-4(1H)-carboxamide |
ChEMBL | CHEMBL4060569 |
DrugBank | |
ZINC |
|
PDB chain | 5vp0 Chain A Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 5vp0 Discovery of Clinical Candidate N-((1S)-1-(3-Fluoro-4-(trifluoromethoxy)phenyl)-2-methoxyethyl)-7-methoxy-2-oxo-2,3-dihydropyrido[2,3-b]pyrazine-4(1H)-carboxamide (TAK-915): A Highly Potent, Selective, and Brain-Penetrating Phosphodiesterase 2A Inhibitor for the Treatment of Cognitive Disorders. |
Resolution | 2.2 Å |
Binding residue (original residue number in PDB) | L770 H773 T805 L809 Q812 I826 M847 Q859 F862 |
Binding residue (residue number reindexed from 1) | L188 H191 T223 L227 Q230 I244 M265 Q277 F280 |
Annotation score | 1 |
Binding affinity | MOAD: ic50=0.61nM PDBbind-CN: -logKd/Ki=9.21,IC50=0.61nM BindingDB: IC50=0.610000nM |
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|