Structure of PDB 5vfd Chain A Binding Site BS02 |
|
|
Ligand ID | 9CM |
InChI | InChI=1S/C8H11N3O6S/c1-4-2-5(7(9)12)10-3-6(4)11(8(10)13)17-18(14,15)16/h2,5-6H,3H2,1H3,(H2,9,12)(H,14,15,16)/t5-,6-/m0/s1 |
InChIKey | WHFPRPRSXFJXMN-WDSKDSINSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1=C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)O)C(=O)N | OpenEye OEToolkits 2.0.6 | CC1=CC(N2CC1N(C2=O)OS(=O)(=O)O)C(=O)N | CACTVS 3.385 | CC1=C[C@H]([N@]2C[C@@H]1N(O[S](O)(=O)=O)C2=O)C(N)=O | ACDLabs 12.01 | C1(=CC(C(N)=O)N2CC1N(C2=O)OS(=O)(O)=O)C | CACTVS 3.385 | CC1=C[CH]([N]2C[CH]1N(O[S](O)(=O)=O)C2=O)C(N)=O |
|
Formula | C8 H11 N3 O6 S |
Name | (2S,5R)-4-methyl-7-oxo-6-(sulfooxy)-1,6-diazabicyclo[3.2.1]oct-3-ene-2-carboxamide |
ChEMBL | CHEMBL3140306 |
DrugBank | |
ZINC | ZINC000103245006
|
PDB chain | 5vfd Chain A Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|