Structure of PDB 5up0 Chain A Binding Site BS02 |
|
|
Ligand ID | 8HP |
InChI | InChI=1S/C18H15ClN4OS/c19-12-7-5-11(6-8-12)9-22-17-15(13-3-1-2-4-14(13)25-17)16-20-10-21-23(16)18(22)24/h5-8,10H,1-4,9H2 |
InChIKey | SRUIZVZXCPBTGE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c5c(CN3C(n4c(c2c1CCCCc1sc23)ncn4)=O)ccc(c5)Cl | OpenEye OEToolkits 2.0.6 | c1cc(ccc1CN2c3c(c4c(s3)CCCC4)-c5ncnn5C2=O)Cl | CACTVS 3.385 | Clc1ccc(CN2C(=O)n3ncnc3c4c5CCCCc5sc24)cc1 |
|
Formula | C18 H15 Cl N4 O S |
Name | 6-[(4-chlorophenyl)methyl]-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-5(6H)-one |
ChEMBL | CHEMBL1463540 |
DrugBank | |
ZINC | ZINC000002890884
|
PDB chain | 5up0 Chain A Residue 603
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|