Structure of PDB 5u62 Chain A Binding Site BS02 |
|
|
Ligand ID | 7WD |
InChI | InChI=1S/C15H17N3O2/c16-15-17-7-12-5-4-10(8-18(12)15)6-11-2-1-3-13-14(11)20-9-19-13/h1-3,7,10H,4-6,8-9H2,(H2,16,17)/t10-/m0/s1 |
InChIKey | GXMMFNNBTMLUSG-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncc2CC[CH](Cn12)Cc3cccc4OCOc34 | CACTVS 3.385 | Nc1ncc2CC[C@H](Cn12)Cc3cccc4OCOc34 | OpenEye OEToolkits 2.0.6 | c1cc(c2c(c1)OCO2)CC3CCc4cnc(n4C3)N | OpenEye OEToolkits 2.0.6 | c1cc(c2c(c1)OCO2)C[C@@H]3CCc4cnc(n4C3)N | ACDLabs 12.01 | c14OCOc1c(CC3CCc2cnc(n2C3)N)ccc4 |
|
Formula | C15 H17 N3 O2 |
Name | (6S)-6-[(2H-1,3-benzodioxol-4-yl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905374
|
PDB chain | 5u62 Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|