Structure of PDB 5u0g Chain A Binding Site BS02 |
|
|
Ligand ID | 7QY |
InChI | InChI=1S/C12H13NO4S/c1-16-8-4-3-7(9(6-8)17-2)5-10-11(14)13-12(15)18-10/h3-4,6,10H,5H2,1-2H3,(H,13,14,15)/t10-/m1/s1 |
InChIKey | KGQRHOMYUSKNBZ-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(C[CH]2SC(=O)NC2=O)c(OC)c1 | OpenEye OEToolkits 2.0.6 | COc1ccc(c(c1)OC)C[C@@H]2C(=O)NC(=O)S2 | OpenEye OEToolkits 2.0.6 | COc1ccc(c(c1)OC)CC2C(=O)NC(=O)S2 | CACTVS 3.385 | COc1ccc(C[C@H]2SC(=O)NC2=O)c(OC)c1 | ACDLabs 12.01 | c1cc(cc(c1CC2C(NC(S2)=O)=O)OC)OC |
|
Formula | C12 H13 N O4 S |
Name | (5R)-5-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5u0g Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|