Structure of PDB 5tpa Chain A Binding Site BS02 |
|
|
Ligand ID | 7H2 |
InChI | InChI=1S/C18H13ClF3N5O/c1-9-2-3-15-24-11(8-26-14(19)6-13(25-26)18(20,21)22)5-16(28)27(15)17(9)12-4-10(12)7-23/h2-3,5-6,10,12H,4,8H2,1H3/t10-,12+/m0/s1 |
InChIKey | PXLJMGCNGCDJTO-CMPLNLGQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1=C(N2C(=NC(=CC2=O)Cn3c(cc(n3)C(F)(F)F)Cl)C=C1)C4CC4C#N | ACDLabs 12.01 | C=3C2=NC(Cn1nc(cc1Cl)C(F)(F)F)=CC(N2C(=C(C=3)C)C4CC4C#N)=O | CACTVS 3.385 | CC1=C([C@@H]2C[C@H]2C#N)N3C(=O)C=C(Cn4nc(cc4Cl)C(F)(F)F)N=C3C=C1 | OpenEye OEToolkits 2.0.6 | CC1=C(N2C(=NC(=CC2=O)Cn3c(cc(n3)C(F)(F)F)Cl)C=C1)[C@@H]4C[C@H]4C#N | CACTVS 3.385 | CC1=C([CH]2C[CH]2C#N)N3C(=O)C=C(Cn4nc(cc4Cl)C(F)(F)F)N=C3C=C1 |
|
Formula | C18 H13 Cl F3 N5 O |
Name | (1R,2R)-2-(2-{[5-chloro-3-(trifluoromethyl)-1H-pyrazol-1-yl]methyl}-7-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-6-yl)cyclopropane-1-carbonitrile |
ChEMBL | CHEMBL3983039 |
DrugBank | |
ZINC | ZINC000584905430
|
PDB chain | 5tpa Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|