Structure of PDB 5tk9 Chain A Binding Site BS02 |
|
|
Ligand ID | 7D7 |
InChI | InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-5(1-16)6(2-17)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6-,10-/m1/s1 |
InChIKey | LMJVXGOFWKVXAW-OXOINMOOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@H](O3)CO)CO)N | OpenEye OEToolkits 2.0.6 | c1nc(c2c(n1)n(cn2)C3C(C(O3)CO)CO)N | CACTVS 3.385 | Nc1ncnc2n(cnc12)[CH]3O[CH](CO)[CH]3CO | ACDLabs 12.01 | O1C(C(C1CO)CO)n2c3c(nc2)c(N)ncn3 | CACTVS 3.385 | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO)[C@H]3CO |
|
Formula | C10 H13 N5 O3 |
Name | [(2S,3R,4R)-4-(6-amino-9H-purin-9-yl)oxetane-2,3-diyl]dimethanol; OXETANOCIN |
ChEMBL | CHEMBL116430 |
DrugBank | |
ZINC |
|
PDB chain | 5tk9 Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|