Structure of PDB 5svf Chain A Binding Site BS02 |
|
|
Ligand ID | 70P |
InChI | InChI=1S/C18H22N4O2/c1-12(2)15-11-24-18(23)22(15)16-9-10-19-17(21-16)20-13(3)14-7-5-4-6-8-14/h4-10,12-13,15H,11H2,1-3H3,(H,19,20,21)/t13-,15+/m0/s1 |
InChIKey | CUTPLPKYQGWUBC-DZGCQCFKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[CH]1COC(=O)N1c2ccnc(N[CH](C)c3ccccc3)n2 | OpenEye OEToolkits 2.0.5 | CC(C)C1COC(=O)N1c2ccnc(n2)NC(C)c3ccccc3 | ACDLabs 12.01 | c1cccc(c1)C(C)Nc2nccc(n2)N3C(COC3=O)C(C)C | OpenEye OEToolkits 2.0.5 | C[C@@H](c1ccccc1)Nc2nccc(n2)N3[C@H](COC3=O)C(C)C | CACTVS 3.385 | CC(C)[C@H]1COC(=O)N1c2ccnc(N[C@@H](C)c3ccccc3)n2 |
|
Formula | C18 H22 N4 O2 |
Name | (4S)-3-(2-{[(1S)-1-phenylethyl]amino}pyrimidin-4-yl)-4-(propan-2-yl)-1,3-oxazolidin-2-one |
ChEMBL | CHEMBL3672097 |
DrugBank | |
ZINC | ZINC000142143087
|
PDB chain | 5svf Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.42: isocitrate dehydrogenase (NADP(+)). |
|
|
|