Structure of PDB 5sra Chain A Binding Site BS02 |
|
|
Ligand ID | R0L |
InChI | InChI=1S/C15H13FN4O3/c16-8-1-2-9-10(5-8)19-13-12(9)14(18-7-17-13)20-3-4-23-11(6-20)15(21)22/h1-2,5,7,11H,3-4,6H2,(H,21,22)(H,17,18,19)/t11-/m1/s1 |
InChIKey | LNMHSQWGJNVQMD-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)[nH]c3c2c(ncn3)N4CCO[C@H](C4)C(=O)O | ACDLabs 12.01 | O=C(O)C1CN(CCO1)c1ncnc2[NH]c3cc(F)ccc3c12 | CACTVS 3.385 | OC(=O)[C@H]1CN(CCO1)c2ncnc3[nH]c4cc(F)ccc4c23 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)[nH]c3c2c(ncn3)N4CCOC(C4)C(=O)O | CACTVS 3.385 | OC(=O)[CH]1CN(CCO1)c2ncnc3[nH]c4cc(F)ccc4c23 |
|
Formula | C15 H13 F N4 O3 |
Name | (2R)-4-(7-fluoro-9H-pyrimido[4,5-b]indol-4-yl)morpholine-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5sra Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|