Structure of PDB 5sou Chain A Binding Site BS02 |
|
|
Ligand ID | RZ9 |
InChI | InChI=1S/C13H14N6O2/c20-13-18-17-12(21-13)8-2-1-5-19(6-8)11-9-3-4-14-10(9)15-7-16-11/h3-4,7-8H,1-2,5-6H2,(H,18,20)(H,14,15,16)/t8-/m0/s1 |
InChIKey | FSJZPCQWTVULBE-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1c[nH]c2c1c(ncn2)N3CCCC(C3)C4=NNC(=O)O4 | ACDLabs 12.01 | O=C1NN=C(O1)C1CN(CCC1)c1ncnc2[NH]ccc21 | CACTVS 3.385 | O=C1NN=C(O1)[CH]2CCCN(C2)c3ncnc4[nH]ccc34 | OpenEye OEToolkits 2.0.7 | c1c[nH]c2c1c(ncn2)N3CCC[C@@H](C3)C4=NNC(=O)O4 | CACTVS 3.385 | O=C1NN=C(O1)[C@H]2CCCN(C2)c3ncnc4[nH]ccc34 |
|
Formula | C13 H14 N6 O2 |
Name | 5-[(3S)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-1,3,4-oxadiazol-2(3H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5sou Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|