Structure of PDB 5sjk Chain A Binding Site BS02 |
|
|
Ligand ID | K40 |
InChI | InChI=1S/C11H8Cl2N2O/c12-6-1-2-7(13)10-8(6)5-3-4-14-11(16)9(5)15-10/h1-2,15H,3-4H2,(H,14,16) |
InChIKey | VJUGVVOGVWAGRV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NCCc2c1[NH]c1c(Cl)ccc(Cl)c12 | CACTVS 3.385 | Clc1ccc(Cl)c2c3CCNC(=O)c3[nH]c12 | OpenEye OEToolkits 2.0.7 | c1cc(c2c(c1Cl)c3c([nH]2)C(=O)NCC3)Cl |
|
Formula | C11 H8 Cl2 N2 O |
Name | 5,8-dichloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-one |
ChEMBL | CHEMBL1345945 |
DrugBank | |
ZINC | ZINC000000077281
|
PDB chain | 5sjk Chain A Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|