Structure of PDB 5r4t Chain A Binding Site BS02 |
|
|
Ligand ID | RWG |
InChI | InChI=1S/C14H13FN4O2/c1-14(12(20)6-13(21)16-14)7-10-8-19(18-17-10)11-4-2-9(15)3-5-11/h2-5,8H,6-7H2,1H3,(H,16,21)/t14-/m1/s1 |
InChIKey | UUBOMXRWPFJYHC-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@]1(C(=O)CC(=O)N1)Cc2cn(nn2)c3ccc(cc3)F | CACTVS 3.385 | C[C@]1(Cc2cn(nn2)c3ccc(F)cc3)NC(=O)CC1=O | CACTVS 3.385 | C[C]1(Cc2cn(nn2)c3ccc(F)cc3)NC(=O)CC1=O | ACDLabs 12.01 | n2nn(c1ccc(F)cc1)cc2CC3(C)NC(=O)CC3=O | OpenEye OEToolkits 2.0.6 | CC1(C(=O)CC(=O)N1)Cc2cn(nn2)c3ccc(cc3)F |
|
Formula | C14 H13 F N4 O2 |
Name | (5R)-5-{[1-(4-fluorophenyl)-1H-1,2,3-triazol-4-yl]methyl}-5-methylpyrrolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5r4t Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|