Structure of PDB 5qq8 Chain A Binding Site BS02 |
|
|
Ligand ID | LXS |
InChI | InChI=1S/C15H16N2O4/c1-2-16-10(18)7-17(15(16)20)11-12(19)14-9-6-4-3-5-8(9)13(11)21-14/h3-6,11-14,19H,2,7H2,1H3/t11-,12-,13-,14+/m0/s1 |
InChIKey | GHZIAZMBFWRVPL-XDQVBPFNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCN1C(=O)CN(C1=O)[C@@H]2[C@@H]3c4ccccc4[C@H]([C@H]2O)O3 | CACTVS 3.385 | CCN1C(=O)CN([C@H]2[C@H](O)[C@@H]3O[C@H]2c4ccccc34)C1=O | OpenEye OEToolkits 2.0.6 | CCN1C(=O)CN(C1=O)C2C3c4ccccc4C(C2O)O3 | CACTVS 3.385 | CCN1C(=O)CN([CH]2[CH](O)[CH]3O[CH]2c4ccccc34)C1=O |
|
Formula | C15 H16 N2 O4 |
Name | 3-ethyl-1-[(1~{R},8~{S},9~{S},10~{S})-10-oxidanyl-11-oxatricyclo[6.2.1.0^{2,7}]undeca-2(7),3,5-trien-9-yl]imidazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5qq8 Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|