Structure of PDB 5qq7 Chain A Binding Site BS02 |
|
|
Ligand ID | LXM |
InChI | InChI=1S/C18H17NO3/c20-11-13-10-19(18(21)12-6-2-1-3-7-12)16-14-8-4-5-9-15(14)22-17(13)16/h1-9,13,16-17,20H,10-11H2/t13-,16-,17-/m0/s1 |
InChIKey | VKQHNAPJGDBELB-JQFCIGGWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@@H]1CN([C@@H]2[C@H]1Oc3ccccc23)C(=O)c4ccccc4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C(=O)N2C[C@H]([C@H]3[C@@H]2c4ccccc4O3)CO | CACTVS 3.385 | OC[CH]1CN([CH]2[CH]1Oc3ccccc23)C(=O)c4ccccc4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C(=O)N2CC(C3C2c4ccccc4O3)CO |
|
Formula | C18 H17 N O3 |
Name | [(3~{S},3~{a}~{S},8~{b}~{S})-3-(hydroxymethyl)-2,3,3~{a},8~{b}-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-phenyl-methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5qq7 Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|