Structure of PDB 5q1g Chain A Binding Site BS02 |
|
|
Ligand ID | 9NM |
InChI | InChI=1S/C22H29FN2O2/c23-18-14-11-17(12-15-18)13-16-21(26)25(20-9-5-2-6-10-20)22(27)24-19-7-3-1-4-8-19/h11-16,19-20H,1-10H2,(H,24,27)/b16-13+ |
InChIKey | GUDFNCYAKAJWRN-DTQAZKPQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1ccc(cc1)/C=C/C(=O)N(C2CCCCC2)C(=O)NC3CCCCC3 | CACTVS 3.385 | Fc1ccc(cc1)C=CC(=O)N(C2CCCCC2)C(=O)NC3CCCCC3 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1C=CC(=O)N(C2CCCCC2)C(=O)NC3CCCCC3)F | OpenEye OEToolkits 2.0.6 | c1cc(ccc1/C=C/C(=O)N(C2CCCCC2)C(=O)NC3CCCCC3)F | ACDLabs 12.01 | C1CCCCC1N(C(=O)NC2CCCCC2)C(=O)\C=C\c3ccc(F)cc3 |
|
Formula | C22 H29 F N2 O2 |
Name | (2E)-N-cyclohexyl-N-(cyclohexylcarbamoyl)-3-(4-fluorophenyl)prop-2-enamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q1g Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|