Structure of PDB 5q0w Chain A Binding Site BS02 |
|
|
Ligand ID | 9LV |
InChI | InChI=1S/C26H22BrClN2O5S/c27-19-9-10-22-20(15-19)26(25(33)30(22)16-17-5-7-18(8-6-17)24(31)32)11-13-29(14-12-26)36(34,35)23-4-2-1-3-21(23)28/h1-10,15H,11-14,16H2,(H,31,32) |
InChIKey | SWIFZZMVSPDAPN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)S(=O)(=O)N2CCC3(CC2)c4cc(ccc4N(C3=O)Cc5ccc(cc5)C(=O)O)Br)Cl | CACTVS 3.385 | OC(=O)c1ccc(CN2C(=O)C3(CCN(CC3)[S](=O)(=O)c4ccccc4Cl)c5cc(Br)ccc25)cc1 | ACDLabs 12.01 | C41(C(N(c2c1cc(Br)cc2)Cc3ccc(cc3)C(O)=O)=O)CCN(CC4)S(c5c(cccc5)Cl)(=O)=O |
|
Formula | C26 H22 Br Cl N2 O5 S |
Name | 4-({5-bromo-1'-[(2-chlorophenyl)sulfonyl]-2-oxospiro[indole-3,4'-piperidin]-1(2H)-yl}methyl)benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q0w Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|