Structure of PDB 5q0j Chain A Binding Site BS02 |
|
|
Ligand ID | 9KV |
InChI | InChI=1S/C31H35N3OS/c35-31(32-24-16-8-3-9-17-24)29(23-14-6-2-7-15-23)34-26-19-11-10-18-25(26)33-30(34)28-21-20-27(36-28)22-12-4-1-5-13-22/h1,4-5,10-13,18-21,23-24,29H,2-3,6-9,14-17H2,(H,32,35)/t29-/m0/s1 |
InChIKey | AUFPVOAEDLSRHU-LJAQVGFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2ccc(s2)c3nc4ccccc4n3[C@@H](C5CCCCC5)C(=O)NC6CCCCC6 | CACTVS 3.385 | O=C(NC1CCCCC1)[CH](C2CCCCC2)n3c4ccccc4nc3c5sc(cc5)c6ccccc6 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2ccc(s2)c3nc4ccccc4n3C(C5CCCCC5)C(=O)NC6CCCCC6 | CACTVS 3.385 | O=C(NC1CCCCC1)[C@H](C2CCCCC2)n3c4ccccc4nc3c5sc(cc5)c6ccccc6 | ACDLabs 12.01 | n3c6c(n(C(C(=O)NC1CCCCC1)C2CCCCC2)c3c5ccc(c4ccccc4)s5)cccc6 |
|
Formula | C31 H35 N3 O S |
Name | (2S)-N,2-dicyclohexyl-2-[2-(5-phenylthiophen-2-yl)-1H-benzimidazol-1-yl]acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5q0j Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|