Structure of PDB 5p92 Chain A Binding Site BS02 |
|
|
Ligand ID | 76G |
InChI | InChI=1S/C24H21FN2O3S/c25-18-6-4-15(5-7-18)17-12-20(23(29)21(28)13-17)24(30)27-9-2-1-3-19-11-16-8-10-26-14-22(16)31-19/h4-8,10-14,28-29H,1-3,9H2,(H,27,30) |
InChIKey | XMHHXGQAUPXIKY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N(CCCCc2cc1c(cncc1)s2)C(c3c(c(cc(c3)c4ccc(cc4)F)O)O)=O | OpenEye OEToolkits 2.0.6 | c1cc(ccc1c2cc(c(c(c2)O)O)C(=O)NCCCCc3cc4ccncc4s3)F | CACTVS 3.385 | Oc1cc(cc(c1O)C(=O)NCCCCc2sc3cnccc3c2)c4ccc(F)cc4 |
|
Formula | C24 H21 F N2 O3 S |
Name | 5-(4-fluorophenyl)-2,3-dihydroxy-N-(4-thieno[2,3-c]pyridin-2-ylbutyl)benzamide; 4'-fluoro-4,5-dihydroxy-N-[4-(thieno[2,3-c]pyridin-2-yl)butyl][1,1'-biphenyl]-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5p92 Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|