Structure of PDB 5oip Chain A Binding Site BS02 |
|
|
Ligand ID | 9WE |
InChI | InChI=1S/C16H20N6O/c23-16(20-12-13-3-1-6-17-11-13)21-14-4-9-22(10-5-14)15-18-7-2-8-19-15/h1-3,6-8,11,14H,4-5,9-10,12H2,(H2,20,21,23) |
InChIKey | GHIMGULMAMLLAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(NCc1cccnc1)NC2CCN(CC2)c3ncccn3 | OpenEye OEToolkits 2.0.6 | c1cc(cnc1)CNC(=O)NC2CCN(CC2)c3ncccn3 |
|
Formula | C16 H20 N6 O |
Name | 1-(pyridin-3-ylmethyl)-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000044946396
|
PDB chain | 5oip Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|