Structure of PDB 5ny1 Chain A Binding Site BS02 |
|
|
Ligand ID | 9E5 |
InChI | InChI=1S/C19H20N2O4S/c1-11-4-9-16-13(3)18(25-17(16)12(11)2)19(22)21-10-14-5-7-15(8-6-14)26(20,23)24/h4-9H,10H2,1-3H3,(H,21,22)(H2,20,23,24) |
InChIKey | UTFNKOUSVJRLOG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1ccc2c(c(oc2c1C)C(=O)NCc3ccc(cc3)S(=O)(=O)N)C | CACTVS 3.385 | Cc1ccc2c(C)c(oc2c1C)C(=O)NCc3ccc(cc3)[S](N)(=O)=O |
|
Formula | C19 H20 N2 O4 S |
Name | 3,6,7-trimethyl-~{N}-[(4-sulfamoylphenyl)methyl]-1-benzofuran-2-carboxamide |
ChEMBL | CHEMBL1505114 |
DrugBank | |
ZINC | ZINC000000634047
|
PDB chain | 5ny1 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|