Structure of PDB 5nxw Chain A Binding Site BS02 |
|
|
Ligand ID | RA9 |
InChI | InChI=1S/C10H11N5O3S3/c11-9-14-15-10(20-9)19-5-8(16)13-6-1-3-7(4-2-6)21(12,17)18/h1-4H,5H2,(H2,11,14)(H,13,16)(H2,12,17,18) |
InChIKey | XOOCPGSAGIALAP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(ccc1NC(=O)CSc2nnc(s2)N)S(=O)(=O)N | CACTVS 3.385 | Nc1sc(SCC(=O)Nc2ccc(cc2)[S](N)(=O)=O)nn1 |
|
Formula | C10 H11 N5 O3 S3 |
Name | 2-[(5-azanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-~{N}-(4-sulfamoylphenyl)ethanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002260391
|
PDB chain | 5nxw Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|