Structure of PDB 5n0e Chain A Binding Site BS02 |
|
|
Ligand ID | 8F3 |
InChI | InChI=1S/C22H20N2O5S/c23-30(28,29)17-8-6-15(7-9-17)22(27)24-11-10-16-12-19(25)20(26)13-18(16)21(24)14-4-2-1-3-5-14/h1-9,12-13,21,25-26H,10-11H2,(H2,23,28,29)/t21-/m0/s1 |
InChIKey | UBKCMPKCMMEDIG-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[S](=O)(=O)c1ccc(cc1)C(=O)N2CCc3cc(O)c(O)cc3[CH]2c4ccccc4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2c3cc(c(cc3CCN2C(=O)c4ccc(cc4)S(=O)(=O)N)O)O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[C@H]2c3cc(c(cc3CCN2C(=O)c4ccc(cc4)S(=O)(=O)N)O)O | CACTVS 3.385 | N[S](=O)(=O)c1ccc(cc1)C(=O)N2CCc3cc(O)c(O)cc3[C@@H]2c4ccccc4 |
|
Formula | C22 H20 N2 O5 S |
Name | 4-[[(1~{S})-6,7-bis(oxidanyl)-1-phenyl-3,4-dihydro-1~{H}-isoquinolin-2-yl]carbonyl]benzenesulfonamide |
ChEMBL | CHEMBL4095957 |
DrugBank | |
ZINC |
|
PDB chain | 5n0e Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|