Structure of PDB 5mex Chain A Binding Site BS02 |
|
|
Ligand ID | SZZ |
InChI | InChI=1S/C10H17NO9S2/c1-2-3-6(11-20-22(16,17)18)21-10-9(15)8(14)7(13)5(4-12)19-10/h2,5,7-10,12-15H,1,3-4H2,(H,16,17,18)/b11-6+/t5-,7-,8+,9-,10+/m1/s1 |
InChIKey | PHZOWSSBXJXFOR-PTGZALFTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C=CCC(=NOS(=O)(=O)O)SC1C(C(C(C(O1)CO)O)O)O | CACTVS 3.385 | OC[C@H]1O[C@@H](SC(/CC=C)=N/O[S](O)(=O)=O)[C@H](O)[C@@H](O)[C@@H]1O | CACTVS 3.385 | OC[CH]1O[CH](SC(CC=C)=NO[S](O)(=O)=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 2.0.6 | C=CC/C(=N\OS(=O)(=O)O)/S[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
|
Formula | C10 H17 N O9 S2 |
Name | Sinigrin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013527691
|
PDB chain | 5mex Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K93 H155 S185 |
Catalytic site (residue number reindexed from 1) |
K68 H130 S160 |
Enzyme Commision number |
2.8.2.38: aliphatic desulfoglucosinolate sulfotransferase. |
|
|
Molecular Function |
GO:0008146 |
sulfotransferase activity |
GO:0016740 |
transferase activity |
GO:0047364 |
desulfoglucosinolate sulfotransferase activity |
GO:0080066 |
3-methylthiopropyl-desulfoglucosinolate sulfotransferase activity |
GO:0080067 |
4-methylthiobutyl-desulfoglucosinolate sulfotransferase activity |
GO:0080068 |
5-methylthiopentyl-desulfoglucosinolate sulfotransferase activity |
GO:0080069 |
7-methylthioheptyl-desulfoglucosinolate sulfotransferase activity |
GO:0080070 |
8-methylthiooctyl-desulfoglucosinolate sulfotransferase activity |
GO:0080071 |
indol-3-yl-methyl-desulfoglucosinolate sulfotransferase activity |
|
|