Structure of PDB 5m77 Chain A Binding Site BS02 |
|
|
Ligand ID | 7K3 |
InChI | InChI=1S/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(12)11-2/h2-10,12H,1H2/t2-,3-,4+,5+,6-/m1/s1 |
InChIKey | JUSMHIGDXPKSID-RWOPYEJCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)S)O)O)O)O | CACTVS 3.385 | OC[C@H]1O[C@H](S)[C@@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 2.0.6 | C(C1C(C(C(C(O1)S)O)O)O)O | CACTVS 3.385 | OC[CH]1O[CH](S)[CH](O)[CH](O)[CH]1O |
|
Formula | C6 H12 O5 S |
Name | 1-thio-alpha-D-mannopyranose; (2~{R},3~{S},4~{S},5~{S},6~{R})-2-(hydroxymethyl)-6-sulfanyl-oxane-3,4,5-triol; 1-thio-alpha-D-mannose; 1-thio-D-mannose; 1-thio-mannose |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5m77 Chain C Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|