Structure of PDB 5lmd Chain A Binding Site BS02 |
|
|
Ligand ID | RC4 |
InChI | InChI=1S/C16H18BN2O5/c1-10-3-6-15(23-2)14(7-10)19-16(20)18-12-5-4-11-9-24-17(21,22)13(11)8-12/h3-8,21-22H,9H2,1-2H3,(H2,18,19,20)/q-1 |
InChIKey | DMOTUOXBEBOMAL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(C)cc1NC(=O)Nc2ccc3CO[B-](O)(O)c3c2 | OpenEye OEToolkits 2.0.5 | [B-]1(c2cc(ccc2CO1)NC(=O)Nc3cc(ccc3OC)C)(O)O |
|
Formula | C16 H18 B N2 O5 |
Name | 1-[7,7-bis(oxidanyl)-8-oxa-7-boranuidabicyclo[4.3.0]nona-1,3,5-trien-4-yl]-3-(2-methoxy-5-methyl-phenyl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905649
|
PDB chain | 5lmd Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|