Structure of PDB 5l8c Chain A Binding Site BS02 |
|
|
|
| Ligand ID | 908 |
| InChI | InChI=1S/C27H30N4O4/c1-16(2)31-27(34)21-7-5-4-6-20(21)25(30-31)19-12-13-23(35-3)22(14-19)17-8-10-18(11-9-17)26(33)29-15-24(28)32/h4-5,8-14,16,20-21H,6-7,15H2,1-3H3,(H2,28,32)(H,29,33)/t20-,21+/m0/s1 |
| InChIKey | STNWAGAHKRPYDJ-LEWJYISDSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.5 | CC(C)N1C(=O)[C@@H]2CC=CC[C@@H]2C(=N1)c3ccc(c(c3)c4ccc(cc4)C(=O)NCC(=O)N)OC | | CACTVS 3.385 | COc1ccc(cc1c2ccc(cc2)C(=O)NCC(N)=O)C3=NN(C(C)C)C(=O)[CH]4CC=CC[CH]34 | | OpenEye OEToolkits 2.0.5 | CC(C)N1C(=O)C2CC=CCC2C(=N1)c3ccc(c(c3)c4ccc(cc4)C(=O)NCC(=O)N)OC | | CACTVS 3.385 | COc1ccc(cc1c2ccc(cc2)C(=O)NCC(N)=O)C3=NN(C(C)C)C(=O)[C@@H]4CC=CC[C@H]34 |
|
| Formula | C27 H30 N4 O4 |
| Name | 4-[5-[(4~{a}~{R},8~{a}~{S})-4-oxidanylidene-3-propan-2-yl-4~{a},5,8,8~{a}-tetrahydrophthalazin-1-yl]-2-methoxy-phenyl]-~{N}-(2-azanyl-2-oxidanylidene-ethyl)benzamide |
| ChEMBL | CHEMBL4204999 |
| DrugBank | |
| ZINC |
|
| PDB chain | 5l8c Chain A Residue 1007
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
