Structure of PDB 5l11 Chain A Binding Site BS02 |
|
|
Ligand ID | RJW |
InChI | InChI=1S/C28H34O/c1-3-4-5-8-17-24-20-25-26(29)18-19-28(25,21(2)22-13-9-6-10-14-22)27(24)23-15-11-7-12-16-23/h6-7,9-16,25-26,29H,2-5,8,17-20H2,1H3/t25-,26+,28-/m0/s1 |
InChIKey | ZFXMYHPLTQTTFW-REUBFRLUSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC1CCC2(C1CC(CCCCCC)=C2c3ccccc3)/C(c4ccccc4)=C | CACTVS 3.385 | CCCCCCC1=C(c2ccccc2)[C]3(CC[CH](O)[CH]3C1)C(=C)c4ccccc4 | CACTVS 3.385 | CCCCCCC1=C(c2ccccc2)[C@@]3(CC[C@@H](O)[C@@H]3C1)C(=C)c4ccccc4 | OpenEye OEToolkits 2.0.5 | CCCCCCC1=C(C2(CCC(C2C1)O)C(=C)c3ccccc3)c4ccccc4 | OpenEye OEToolkits 2.0.5 | CCCCCCC1=C([C@@]2(CC[C@H]([C@@H]2C1)O)C(=C)c3ccccc3)c4ccccc4 |
|
Formula | C28 H34 O |
Name | (1R,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-1,2,3,3a,6,6a-hexahydropentalen-1-ol |
ChEMBL | CHEMBL1765959 |
DrugBank | |
ZINC | ZINC000071318097
|
PDB chain | 5l11 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|