Structure of PDB 5jic Chain A Binding Site BS02 |
|
|
Ligand ID | N7E |
InChI | InChI=1S/C15H31N2O8P/c1-15(2,11-25-26(21,22)23)13(19)14(20)17-9-7-12(18)16-8-5-4-6-10-24-3/h13,19H,4-11H2,1-3H3,(H,16,18)(H,17,20)(H2,21,22,23)/t13-/m0/s1 |
InChIKey | FOBYDOXAQNKICH-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COCCCCCNC(=O)CCNC(=O)[CH](O)C(C)(C)CO[P](O)(O)=O | ACDLabs 12.01 | OP(O)(=O)OCC(C(O)C(=O)NCCC(=O)NCCCCCOC)(C)C | OpenEye OEToolkits 2.0.4 | CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)NCCCCCOC)O | CACTVS 3.385 | COCCCCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO[P](O)(O)=O | OpenEye OEToolkits 2.0.4 | CC(C)(COP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCCCCOC)O |
|
Formula | C15 H31 N2 O8 P |
Name | N~3~-[(2R)-2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoyl]-N-(5-methoxypentyl)-beta-alaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905778
|
PDB chain | 5jic Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.33: pantothenate kinase. |
|
|
|