Structure of PDB 5je0 Chain A Binding Site BS02 |
|
|
Ligand ID | AZ8 |
InChI | InChI=1S/C5H3N5O2/c11-4-2-3(8-5(12)9-4)10-7-1-6-2/h1H,(H2,8,9,10,11,12) |
InChIKey | IDJLTUNWTSUIHO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c12c(ncnn1)C(=O)NC(=O)N2 | CACTVS 3.385 | O=C1NC(=O)c2ncnnc2N1 | OpenEye OEToolkits 2.0.4 | c1nc2c(nn1)NC(=O)NC2=O |
|
Formula | C5 H3 N5 O2 |
Name | pyrimido[5,4-e][1,2,4]triazine-5,7(6H,8H)-dione; 1,6-didemethyltoxoflavin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001704493
|
PDB chain | 5je0 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|